C18H26N2O6 — CID 129449329
ethyl (2S)-2-ethyl-3-[(3,4,5-trimethoxybenzoyl)hydrazinylidene]butanoate (PubChem CID 129449329) has the molecular formula C18H26N2O6 and a molecular weight of 366.41 g/mol. Its IUPAC name is ethyl (2S)-2-ethyl-3-[(3,4,5-trimethoxybenzoyl)hydrazinylidene]butanoate.
| Compound Name | ethyl (2S)-2-ethyl-3-[(3,4,5-trimethoxybenzoyl)hydrazinylidene]butanoate |
|---|---|
| PubChem CID | 129449329 |
| Molecular Formula | C18H26N2O6 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | ethyl (2S)-2-ethyl-3-[(3,4,5-trimethoxybenzoyl)hydrazinylidene]butanoate |
| SMILES | CCOC(=O)[C@@H](CC)C(C)=NNC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H26N2O6/c1-7-13(18(22)26-8-2)11(3)19-20-17(21)12-9-14(23-4)16(25-6)15(10-12)24-5/h9-10,13H,7-8H2,1-6H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | HHAKEXPPOROJRZ-ZDUSSCGKSA-N |
| XLogP | 2.41 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|