C16H22N2O3 — CID 7104050
ethyl (2S)-2-ethyl-3-[(3-methylbenzoyl)hydrazinylidene]butanoate (PubChem CID 7104050) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is ethyl (2S)-2-ethyl-3-[(3-methylbenzoyl)hydrazinylidene]butanoate.
| Compound Name | ethyl (2S)-2-ethyl-3-[(3-methylbenzoyl)hydrazinylidene]butanoate |
|---|---|
| PubChem CID | 7104050 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | ethyl (2S)-2-ethyl-3-[(3-methylbenzoyl)hydrazinylidene]butanoate |
| SMILES | CCOC(=O)[C@@H](CC)C(C)=NNC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C16H22N2O3/c1-5-14(16(20)21-6-2)12(4)17-18-15(19)13-9-7-8-11(3)10-13/h7-10,14H,5-6H2,1-4H3,(H,18,19)/t14-/m0/s1 |
| InChIKey | XPNZNPZITSTAKW-AWEZNQCLSA-N |
| XLogP | 2.69 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|