C15H19ClN2O3 — CID 129460363
ethyl (2R)-3-[(4-chlorobenzoyl)hydrazinylidene]-2-ethylbutanoate (PubChem CID 129460363) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is ethyl (2R)-3-[(4-chlorobenzoyl)hydrazinylidene]-2-ethylbutanoate.
| Compound Name | ethyl (2R)-3-[(4-chlorobenzoyl)hydrazinylidene]-2-ethylbutanoate |
|---|---|
| PubChem CID | 129460363 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | ethyl (2R)-3-[(4-chlorobenzoyl)hydrazinylidene]-2-ethylbutanoate |
| SMILES | CCOC(=O)[C@H](CC)C(C)=NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H19ClN2O3/c1-4-13(15(20)21-5-2)10(3)17-18-14(19)11-6-8-12(16)9-7-11/h6-9,13H,4-5H2,1-3H3,(H,18,19)/t13-/m1/s1 |
| InChIKey | GMVLVOZYKCSDQS-CYBMUJFWSA-N |
| XLogP | 3.04 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|