C15H19BrN2O3 — CID 7375400
ethyl (2S,3E)-3-[(3-bromobenzoyl)hydrazinylidene]-2-ethylbutanoate (PubChem CID 7375400) has the molecular formula C15H19BrN2O3 and a molecular weight of 355.23 g/mol. Its IUPAC name is ethyl (2S,3E)-3-[(3-bromobenzoyl)hydrazinylidene]-2-ethylbutanoate.
| Compound Name | ethyl (2S,3E)-3-[(3-bromobenzoyl)hydrazinylidene]-2-ethylbutanoate |
|---|---|
| PubChem CID | 7375400 |
| Molecular Formula | C15H19BrN2O3 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | ethyl (2S,3E)-3-[(3-bromobenzoyl)hydrazinylidene]-2-ethylbutanoate |
| SMILES | CCOC(=O)[C@@H](CC)/C(C)=N/NC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H19BrN2O3/c1-4-13(15(20)21-5-2)10(3)17-18-14(19)11-7-6-8-12(16)9-11/h6-9,13H,4-5H2,1-3H3,(H,18,19)/b17-10+/t13-/m0/s1 |
| InChIKey | ZHWKHAAJKAQVLB-VZWMTCDZSA-N |
| XLogP | 3.14 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|