C22H26N2O3 — CID 98075591
ethyl (2S)-2-[(E)-C-methyl-N-[(4-phenylbenzoyl)amino]carbonimidoyl]pentanoate (PubChem CID 98075591) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is ethyl (2S)-2-[(E)-C-methyl-N-[(4-phenylbenzoyl)amino]carbonimidoyl]pentanoate.
| Compound Name | ethyl (2S)-2-[(E)-C-methyl-N-[(4-phenylbenzoyl)amino]carbonimidoyl]pentanoate |
|---|---|
| PubChem CID | 98075591 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | ethyl (2S)-2-[(E)-C-methyl-N-[(4-phenylbenzoyl)amino]carbonimidoyl]pentanoate |
| SMILES | CCC[C@H](C(=O)OCC)/C(C)=N/NC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H26N2O3/c1-4-9-20(22(26)27-5-2)16(3)23-24-21(25)19-14-12-18(13-15-19)17-10-7-6-8-11-17/h6-8,10-15,20H,4-5,9H2,1-3H3,(H,24,25)/b23-16+/t20-/m0/s1 |
| InChIKey | MAZZQAAIDPBRKF-NGIIGVMLSA-N |
| XLogP | 4.44 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|