C28H24N2O — CID 54785301
N-[(E)-1,1-diphenylpropan-2-ylideneamino]-4-phenylbenzamide (PubChem CID 54785301) has the molecular formula C28H24N2O and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[(E)-1,1-diphenylpropan-2-ylideneamino]-4-phenylbenzamide.
| Compound Name | N-[(E)-1,1-diphenylpropan-2-ylideneamino]-4-phenylbenzamide |
|---|---|
| PubChem CID | 54785301 |
| Molecular Formula | C28H24N2O |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | N-[(E)-1,1-diphenylpropan-2-ylideneamino]-4-phenylbenzamide |
| SMILES | C/C(=N\NC(=O)c1ccc(-c2ccccc2)cc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H24N2O/c1-21(27(24-13-7-3-8-14-24)25-15-9-4-10-16-25)29-30-28(31)26-19-17-23(18-20-26)22-11-5-2-6-12-22/h2-20,27H,1H3,(H,30,31)/b29-21+ |
| InChIKey | DYIZMZAGSOCQAN-XHLNEMQHSA-N |
| XLogP | 6.29 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|