C22H20N2O — CID 54785289
N-[(E)-1,1-diphenylpropan-2-ylideneamino]benzamide (PubChem CID 54785289) has the molecular formula C22H20N2O and a molecular weight of 328.42 g/mol. Its IUPAC name is N-[(E)-1,1-diphenylpropan-2-ylideneamino]benzamide.
| Compound Name | N-[(E)-1,1-diphenylpropan-2-ylideneamino]benzamide |
|---|---|
| PubChem CID | 54785289 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | N-[(E)-1,1-diphenylpropan-2-ylideneamino]benzamide |
| SMILES | C/C(=N\NC(=O)c1ccccc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20N2O/c1-17(23-24-22(25)20-15-9-4-10-16-20)21(18-11-5-2-6-12-18)19-13-7-3-8-14-19/h2-16,21H,1H3,(H,24,25)/b23-17+ |
| InChIKey | BROPOISXSTXIIW-HAVVHWLPSA-N |
| XLogP | 4.62 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|