C19H22N2O2 — CID 54785224
N-[(E)-1,1-diphenylpropan-2-ylideneamino]-2-ethoxyacetamide (PubChem CID 54785224) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[(E)-1,1-diphenylpropan-2-ylideneamino]-2-ethoxyacetamide.
| Compound Name | N-[(E)-1,1-diphenylpropan-2-ylideneamino]-2-ethoxyacetamide |
|---|---|
| PubChem CID | 54785224 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-[(E)-1,1-diphenylpropan-2-ylideneamino]-2-ethoxyacetamide |
| SMILES | CCOCC(=O)N/N=C(\C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O2/c1-3-23-14-18(22)21-20-15(2)19(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,19H,3,14H2,1-2H3,(H,21,22)/b20-15+ |
| InChIKey | MTMFPENAHNBMJX-HMMYKYKNSA-N |
| XLogP | 3.35 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|