C27H30N2O2 — CID 54785277
2-(2-butan-2-ylphenoxy)-N-[(E)-1,1-diphenylpropan-2-ylideneamino]acetamide (PubChem CID 54785277) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-(2-butan-2-ylphenoxy)-N-[(E)-1,1-diphenylpropan-2-ylideneamino]acetamide.
| Compound Name | 2-(2-butan-2-ylphenoxy)-N-[(E)-1,1-diphenylpropan-2-ylideneamino]acetamide |
|---|---|
| PubChem CID | 54785277 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 2-(2-butan-2-ylphenoxy)-N-[(E)-1,1-diphenylpropan-2-ylideneamino]acetamide |
| SMILES | CCC(C)c1ccccc1OCC(=O)N/N=C(\C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30N2O2/c1-4-20(2)24-17-11-12-18-25(24)31-19-26(30)29-28-21(3)27(22-13-7-5-8-14-22)23-15-9-6-10-16-23/h5-18,20,27H,4,19H2,1-3H3,(H,29,30)/b28-21+ |
| InChIKey | PZCHQAOVMXNRPK-SGWCAAJKSA-N |
| XLogP | 5.90 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|