C19H23NO2 — CID 833563
2-[2-[(2S)-butan-2-yl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 833563) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-[2-[(2S)-butan-2-yl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-[(2S)-butan-2-yl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 833563 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-[2-[(2S)-butan-2-yl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CC[C@H](C)c1ccccc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C19H23NO2/c1-4-15(3)17-7-5-6-8-18(17)22-13-19(21)20-16-11-9-14(2)10-12-16/h5-12,15H,4,13H2,1-3H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | OALBKACWVKKCEZ-HNNXBMFYSA-N |
| XLogP | 4.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |