C22H29NO3 — CID 4939634
2-(2-butan-2-ylphenoxy)-N-(4-butoxyphenyl)acetamide (PubChem CID 4939634) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is 2-(2-butan-2-ylphenoxy)-N-(4-butoxyphenyl)acetamide.
| Compound Name | 2-(2-butan-2-ylphenoxy)-N-(4-butoxyphenyl)acetamide |
|---|---|
| PubChem CID | 4939634 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 2-(2-butan-2-ylphenoxy)-N-(4-butoxyphenyl)acetamide |
| SMILES | CCCCOc1ccc(NC(=O)COc2ccccc2C(C)CC)cc1 |
| InChI | InChI=1S/C22H29NO3/c1-4-6-15-25-19-13-11-18(12-14-19)23-22(24)16-26-21-10-8-7-9-20(21)17(3)5-2/h7-14,17H,4-6,15-16H2,1-3H3,(H,23,24) |
| InChIKey | LXCFDTCLVOSQFS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|