C15H21N3O4 — CID 56807746
2-[[2-(2-butan-2-ylphenoxy)acetyl]amino]propanediamide (PubChem CID 56807746) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-[[2-(2-butan-2-ylphenoxy)acetyl]amino]propanediamide.
| Compound Name | 2-[[2-(2-butan-2-ylphenoxy)acetyl]amino]propanediamide |
|---|---|
| PubChem CID | 56807746 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-[[2-(2-butan-2-ylphenoxy)acetyl]amino]propanediamide |
| SMILES | CCC(C)c1ccccc1OCC(=O)NC(C(N)=O)C(N)=O |
| InChI | InChI=1S/C15H21N3O4/c1-3-9(2)10-6-4-5-7-11(10)22-8-12(19)18-13(14(16)20)15(17)21/h4-7,9,13H,3,8H2,1-2H3,(H2,16,20)(H2,17,21)(H,18,19) |
| InChIKey | BACSUVMHARMGAG-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|