C23H31NO5 — CID 55709625
2-(2-butan-2-ylphenoxy)-N-[1-(3,4,5-trimethoxyphenyl)ethyl]acetamide (PubChem CID 55709625) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is 2-(2-butan-2-ylphenoxy)-N-[1-(3,4,5-trimethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(2-butan-2-ylphenoxy)-N-[1-(3,4,5-trimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 55709625 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 2-(2-butan-2-ylphenoxy)-N-[1-(3,4,5-trimethoxyphenyl)ethyl]acetamide |
| SMILES | CCC(C)c1ccccc1OCC(=O)NC(C)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C23H31NO5/c1-7-15(2)18-10-8-9-11-19(18)29-14-22(25)24-16(3)17-12-20(26-4)23(28-6)21(13-17)27-5/h8-13,15-16H,7,14H2,1-6H3,(H,24,25) |
| InChIKey | CTNRXUYOPMUMRF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |