C10H18N2O4 — CID 7278066
ethyl (2S,3Z)-2-ethyl-3-(methoxycarbonylhydrazinylidene)butanoate (PubChem CID 7278066) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is ethyl (2S,3Z)-2-ethyl-3-(methoxycarbonylhydrazinylidene)butanoate.
| Compound Name | ethyl (2S,3Z)-2-ethyl-3-(methoxycarbonylhydrazinylidene)butanoate |
|---|---|
| PubChem CID | 7278066 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | ethyl (2S,3Z)-2-ethyl-3-(methoxycarbonylhydrazinylidene)butanoate |
| SMILES | CCOC(=O)[C@@H](CC)/C(C)=N\NC(=O)OC |
| InChI | InChI=1S/C10H18N2O4/c1-5-8(9(13)16-6-2)7(3)11-12-10(14)15-4/h8H,5-6H2,1-4H3,(H,12,14)/b11-7-/t8-/m0/s1 |
| InChIKey | KIJFHZRXZBDISU-CLUBXZQOSA-N |
| XLogP | 1.31 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|