C21H24N2O6 — CID 40571645
N-[(Z)-[(2S)-3-(1,3-benzodioxol-5-yl)-2-methylpropylidene]amino]-3,4,5-trimethoxybenzamide (PubChem CID 40571645) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is N-[(Z)-[(2S)-3-(1,3-benzodioxol-5-yl)-2-methylpropylidene]amino]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(Z)-[(2S)-3-(1,3-benzodioxol-5-yl)-2-methylpropylidene]amino]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 40571645 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-[(Z)-[(2S)-3-(1,3-benzodioxol-5-yl)-2-methylpropylidene]amino]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)N/N=C\[C@@H](C)Cc2ccc3c(c2)OCO3)cc(OC)c1OC |
| InChI | InChI=1S/C21H24N2O6/c1-13(7-14-5-6-16-17(8-14)29-12-28-16)11-22-23-21(24)15-9-18(25-2)20(27-4)19(10-15)26-3/h5-6,8-11,13H,7,12H2,1-4H3,(H,23,24)/b22-11-/t13-/m0/s1 |
| InChIKey | HYFSAWZLXFPYAR-BTXKWLAHSA-N |
| XLogP | 3.04 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|