C19H26N2O3 — CID 7303161
N-[(Z)-[(2R)-3-(1,3-benzodioxol-5-yl)-2-methylpropylidene]amino]-2-cyclohexylacetamide (PubChem CID 7303161) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is N-[(Z)-[(2R)-3-(1,3-benzodioxol-5-yl)-2-methylpropylidene]amino]-2-cyclohexylacetamide.
| Compound Name | N-[(Z)-[(2R)-3-(1,3-benzodioxol-5-yl)-2-methylpropylidene]amino]-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 7303161 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | N-[(Z)-[(2R)-3-(1,3-benzodioxol-5-yl)-2-methylpropylidene]amino]-2-cyclohexylacetamide |
| SMILES | C[C@@H](/C=N\NC(=O)CC1CCCCC1)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H26N2O3/c1-14(9-16-7-8-17-18(10-16)24-13-23-17)12-20-21-19(22)11-15-5-3-2-4-6-15/h7-8,10,12,14-15H,2-6,9,11,13H2,1H3,(H,21,22)/b20-12-/t14-/m1/s1 |
| InChIKey | DOHHCSLZWYVKOK-FAPYRAKZSA-N |
| XLogP | 3.67 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|