C29H31N5O8 — CID 124530056
N-[(Z)-[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-nitrophenyl]methylideneamino]-3,4,5-trimethoxybenzamide (PubChem CID 124530056) has the molecular formula C29H31N5O8 and a molecular weight of 577.59 g/mol. Its IUPAC name is N-[(Z)-[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-nitrophenyl]methylideneamino]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(Z)-[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-nitrophenyl]methylideneamino]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 124530056 |
| Molecular Formula | C29H31N5O8 |
| Molecular Weight | 577.59 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | N-[(Z)-[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-nitrophenyl]methylideneamino]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)N/N=C\c2ccc(N3CCN(Cc4ccc5c(c4)OCO5)CC3)c([N+](=O)[O-])c2)cc(OC)c1OC |
| InChI | InChI=1S/C29H31N5O8/c1-38-26-14-21(15-27(39-2)28(26)40-3)29(35)31-30-16-19-4-6-22(23(12-19)34(36)37)33-10-8-32(9-11-33)17-20-5-7-24-25(13-20)42-18-41-24/h4-7,12-16H,8-11,17-18H2,1-3H3,(H,31,35)/b30-16- |
| InChIKey | JJQWRYMQMRCHHI-UHBFCERESA-N |
| XLogP | 3.44 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.59 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|