C17H14N3O7- — CID 5064024
4-[(2,3-dihydro-1,4-benzodioxine-6-carbonylhydrazinylidene)methyl]-2-methoxy-6-nitrophenolate (PubChem CID 5064024) has the molecular formula C17H14N3O7- and a molecular weight of 372.31 g/mol. Its IUPAC name is 4-[(2,3-dihydro-1,4-benzodioxine-6-carbonylhydrazinylidene)methyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(2,3-dihydro-1,4-benzodioxine-6-carbonylhydrazinylidene)methyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 5064024 |
| Molecular Formula | C17H14N3O7- |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 4-[(2,3-dihydro-1,4-benzodioxine-6-carbonylhydrazinylidene)methyl]-2-methoxy-6-nitrophenolate |
| SMILES | COc1cc(C=NNC(=O)c2ccc3c(c2)OCCO3)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C17H15N3O7/c1-25-15-7-10(6-12(16(15)21)20(23)24)9-18-19-17(22)11-2-3-13-14(8-11)27-5-4-26-13/h2-3,6-9,21H,4-5H2,1H3,(H,19,22)/p-1 |
| InChIKey | BBIRYADOQMBFOO-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 135.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|