C16H13IN3O6- — CID 7129870
4-[(Z)-[(4-iodo-3-methoxybenzoyl)hydrazinylidene]methyl]-2-methoxy-6-nitrophenolate (PubChem CID 7129870) has the molecular formula C16H13IN3O6- and a molecular weight of 470.20 g/mol. Its IUPAC name is 4-[(Z)-[(4-iodo-3-methoxybenzoyl)hydrazinylidene]methyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(Z)-[(4-iodo-3-methoxybenzoyl)hydrazinylidene]methyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 7129870 |
| Molecular Formula | C16H13IN3O6- |
| Molecular Weight | 470.20 g/mol |
| Exact Mass | 469.99 |
| IUPAC Name | 4-[(Z)-[(4-iodo-3-methoxybenzoyl)hydrazinylidene]methyl]-2-methoxy-6-nitrophenolate |
| SMILES | COc1cc(C(=O)N/N=C\c2cc(OC)c([O-])c([N+](=O)[O-])c2)ccc1I |
| InChI | InChI=1S/C16H14IN3O6/c1-25-13-7-10(3-4-11(13)17)16(22)19-18-8-9-5-12(20(23)24)15(21)14(6-9)26-2/h3-8,21H,1-2H3,(H,19,22)/p-1/b18-8- |
| InChIKey | WDFSAJUDIGODLG-LSCVHKIXSA-M |
| XLogP | 2.05 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|