C15H12IN3O5 — CID 5172323
N-[(4-hydroxy-3-nitrophenyl)methylideneamino]-4-iodo-3-methoxybenzamide (PubChem CID 5172323) has the molecular formula C15H12IN3O5 and a molecular weight of 441.18 g/mol. Its IUPAC name is N-[(4-hydroxy-3-nitrophenyl)methylideneamino]-4-iodo-3-methoxybenzamide.
| Compound Name | N-[(4-hydroxy-3-nitrophenyl)methylideneamino]-4-iodo-3-methoxybenzamide |
|---|---|
| PubChem CID | 5172323 |
| Molecular Formula | C15H12IN3O5 |
| Molecular Weight | 441.18 g/mol |
| Exact Mass | 440.98 |
| IUPAC Name | N-[(4-hydroxy-3-nitrophenyl)methylideneamino]-4-iodo-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NN=Cc2ccc(O)c([N+](=O)[O-])c2)ccc1I |
| InChI | InChI=1S/C15H12IN3O5/c1-24-14-7-10(3-4-11(14)16)15(21)18-17-8-9-2-5-13(20)12(6-9)19(22)23/h2-8,20H,1H3,(H,18,21) |
| InChIKey | FSCCQYRVIRRRQL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.18 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|