C15H13N4O6- — CID 6938592
4-[(Z)-[[6-(hydroxymethyl)pyridine-3-carbonyl]hydrazinylidene]methyl]-2-methoxy-6-nitrophenolate (PubChem CID 6938592) has the molecular formula C15H13N4O6- and a molecular weight of 345.29 g/mol. Its IUPAC name is 4-[(Z)-[[6-(hydroxymethyl)pyridine-3-carbonyl]hydrazinylidene]methyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(Z)-[[6-(hydroxymethyl)pyridine-3-carbonyl]hydrazinylidene]methyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 6938592 |
| Molecular Formula | C15H13N4O6- |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 4-[(Z)-[[6-(hydroxymethyl)pyridine-3-carbonyl]hydrazinylidene]methyl]-2-methoxy-6-nitrophenolate |
| SMILES | COc1cc(/C=N\NC(=O)c2ccc(CO)nc2)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C15H14N4O6/c1-25-13-5-9(4-12(14(13)21)19(23)24)6-17-18-15(22)10-2-3-11(8-20)16-7-10/h2-7,20-21H,8H2,1H3,(H,18,22)/p-1/b17-6- |
| InChIKey | KWTBXOWICDCEKI-FMQZQXMHSA-M |
| XLogP | 0.33 |
| TPSA | 150.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|