C20H16N3O5S- — CID 9027572
2-methoxy-4-[(Z)-[[3-(4-methylphenyl)thiophene-2-carbonyl]hydrazinylidene]methyl]-6-nitrophenolate (PubChem CID 9027572) has the molecular formula C20H16N3O5S- and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-methoxy-4-[(Z)-[[3-(4-methylphenyl)thiophene-2-carbonyl]hydrazinylidene]methyl]-6-nitrophenolate.
| Compound Name | 2-methoxy-4-[(Z)-[[3-(4-methylphenyl)thiophene-2-carbonyl]hydrazinylidene]methyl]-6-nitrophenolate |
|---|---|
| PubChem CID | 9027572 |
| Molecular Formula | C20H16N3O5S- |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 2-methoxy-4-[(Z)-[[3-(4-methylphenyl)thiophene-2-carbonyl]hydrazinylidene]methyl]-6-nitrophenolate |
| SMILES | COc1cc(/C=N\NC(=O)c2sccc2-c2ccc(C)cc2)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C20H17N3O5S/c1-12-3-5-14(6-4-12)15-7-8-29-19(15)20(25)22-21-11-13-9-16(23(26)27)18(24)17(10-13)28-2/h3-11,24H,1-2H3,(H,22,25)/p-1/b21-11- |
| InChIKey | ADOLXPPQEKBWNB-NHDPSOOVSA-M |
| XLogP | 3.48 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|