C13H13N4O6- — CID 8897093
4-[(Z)-[[2-(cyclopropylamino)-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxy-6-nitrophenolate (PubChem CID 8897093) has the molecular formula C13H13N4O6- and a molecular weight of 321.27 g/mol. Its IUPAC name is 4-[(Z)-[[2-(cyclopropylamino)-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(Z)-[[2-(cyclopropylamino)-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 8897093 |
| Molecular Formula | C13H13N4O6- |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 4-[(Z)-[[2-(cyclopropylamino)-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxy-6-nitrophenolate |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)NC2CC2)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C13H14N4O6/c1-23-10-5-7(4-9(11(10)18)17(21)22)6-14-16-13(20)12(19)15-8-2-3-8/h4-6,8,18H,2-3H2,1H3,(H,15,19)(H,16,20)/p-1/b14-6- |
| InChIKey | CFLIFHKHQAMVKW-NSIKDUERSA-M |
| XLogP | -0.59 |
| TPSA | 145.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|