C15H19N4O4S- — CID 7933877
4-[(Z)-(cyclohexylcarbamothioylhydrazinylidene)methyl]-2-methoxy-6-nitrophenolate (PubChem CID 7933877) has the molecular formula C15H19N4O4S- and a molecular weight of 351.41 g/mol. Its IUPAC name is 4-[(Z)-(cyclohexylcarbamothioylhydrazinylidene)methyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(Z)-(cyclohexylcarbamothioylhydrazinylidene)methyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 7933877 |
| Molecular Formula | C15H19N4O4S- |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 4-[(Z)-(cyclohexylcarbamothioylhydrazinylidene)methyl]-2-methoxy-6-nitrophenolate |
| SMILES | COc1cc(/C=N\NC(=S)NC2CCCCC2)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C15H20N4O4S/c1-23-13-8-10(7-12(14(13)20)19(21)22)9-16-18-15(24)17-11-5-3-2-4-6-11/h7-9,11,20H,2-6H2,1H3,(H2,17,18,24)/p-1/b16-9- |
| InChIKey | YEAHVDNGNCQGFO-SXGWCWSVSA-M |
| XLogP | 1.81 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|