C17H17N4O4S- — CID 7930368
4-[(Z)-[(2,6-dimethylphenyl)carbamothioylhydrazinylidene]methyl]-2-methoxy-6-nitrophenolate (PubChem CID 7930368) has the molecular formula C17H17N4O4S- and a molecular weight of 373.41 g/mol. Its IUPAC name is 4-[(Z)-[(2,6-dimethylphenyl)carbamothioylhydrazinylidene]methyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(Z)-[(2,6-dimethylphenyl)carbamothioylhydrazinylidene]methyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 7930368 |
| Molecular Formula | C17H17N4O4S- |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 4-[(Z)-[(2,6-dimethylphenyl)carbamothioylhydrazinylidene]methyl]-2-methoxy-6-nitrophenolate |
| SMILES | COc1cc(/C=N\NC(=S)Nc2c(C)cccc2C)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C17H18N4O4S/c1-10-5-4-6-11(2)15(10)19-17(26)20-18-9-12-7-13(21(23)24)16(22)14(8-12)25-3/h4-9,22H,1-3H3,(H2,19,20,26)/p-1/b18-9- |
| InChIKey | ILLPUWRJFUHZGP-NVMNQCDNSA-M |
| XLogP | 2.61 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|