C16H15N4O3S- — CID 7930371
2-[(Z)-[(2,6-dimethylphenyl)carbamothioylhydrazinylidene]methyl]-4-nitrophenolate (PubChem CID 7930371) has the molecular formula C16H15N4O3S- and a molecular weight of 343.39 g/mol. Its IUPAC name is 2-[(Z)-[(2,6-dimethylphenyl)carbamothioylhydrazinylidene]methyl]-4-nitrophenolate.
| Compound Name | 2-[(Z)-[(2,6-dimethylphenyl)carbamothioylhydrazinylidene]methyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 7930371 |
| Molecular Formula | C16H15N4O3S- |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 2-[(Z)-[(2,6-dimethylphenyl)carbamothioylhydrazinylidene]methyl]-4-nitrophenolate |
| SMILES | Cc1cccc(C)c1NC(=S)N/N=C\c1cc([N+](=O)[O-])ccc1[O-] |
| InChI | InChI=1S/C16H16N4O3S/c1-10-4-3-5-11(2)15(10)18-16(24)19-17-9-12-8-13(20(22)23)6-7-14(12)21/h3-9,21H,1-2H3,(H2,18,19,24)/p-1/b17-9- |
| InChIKey | OQGNTGIXPTVFKE-MFOYZWKCSA-M |
| XLogP | 2.61 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|