C10H11N4O3S- — CID 6993529
2-[(Z)-(ethylcarbamothioylhydrazinylidene)methyl]-4-nitrophenolate (PubChem CID 6993529) has the molecular formula C10H11N4O3S- and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-[(Z)-(ethylcarbamothioylhydrazinylidene)methyl]-4-nitrophenolate.
| Compound Name | 2-[(Z)-(ethylcarbamothioylhydrazinylidene)methyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 6993529 |
| Molecular Formula | C10H11N4O3S- |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-[(Z)-(ethylcarbamothioylhydrazinylidene)methyl]-4-nitrophenolate |
| SMILES | CCNC(=S)N/N=C\c1cc([N+](=O)[O-])ccc1[O-] |
| InChI | InChI=1S/C10H12N4O3S/c1-2-11-10(18)13-12-6-7-5-8(14(16)17)3-4-9(7)15/h3-6,15H,2H2,1H3,(H2,11,13,18)/p-1/b12-6- |
| InChIKey | RBMLXWGQAMURNK-SDQBBNPISA-M |
| XLogP | 0.49 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|