C19H19N5O2S — CID 3515922
1-ethyl-3-[[1-[(3-nitrophenyl)methyl]indol-3-yl]methylideneamino]thiourea (PubChem CID 3515922) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is 1-ethyl-3-[[1-[(3-nitrophenyl)methyl]indol-3-yl]methylideneamino]thiourea.
| Compound Name | 1-ethyl-3-[[1-[(3-nitrophenyl)methyl]indol-3-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 3515922 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 1-ethyl-3-[[1-[(3-nitrophenyl)methyl]indol-3-yl]methylideneamino]thiourea |
| SMILES | CCNC(=S)NN=Cc1cn(Cc2cccc([N+](=O)[O-])c2)c2ccccc12 |
| InChI | InChI=1S/C19H19N5O2S/c1-2-20-19(27)22-21-11-15-13-23(18-9-4-3-8-17(15)18)12-14-6-5-7-16(10-14)24(25)26/h3-11,13H,2,12H2,1H3,(H2,20,22,27) |
| InChIKey | WNFYJBLBWPWIDG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 84.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|