C18H13N4O5- — CID 7046258
2-[(Z)-[(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)hydrazinylidene]methyl]-4-nitrophenolate (PubChem CID 7046258) has the molecular formula C18H13N4O5- and a molecular weight of 365.33 g/mol. Its IUPAC name is 2-[(Z)-[(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)hydrazinylidene]methyl]-4-nitrophenolate.
| Compound Name | 2-[(Z)-[(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)hydrazinylidene]methyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 7046258 |
| Molecular Formula | C18H13N4O5- |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-[(Z)-[(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)hydrazinylidene]methyl]-4-nitrophenolate |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)N/N=C\c1cc([N+](=O)[O-])ccc1[O-] |
| InChI | InChI=1S/C18H14N4O5/c1-11-16(17(21-27-11)12-5-3-2-4-6-12)18(24)20-19-10-13-9-14(22(25)26)7-8-15(13)23/h2-10,23H,1H3,(H,20,24)/p-1/b19-10- |
| InChIKey | BCKTYTPGWISMID-GRSHGNNSSA-M |
| XLogP | 2.40 |
| TPSA | 133.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|