C18H18N3O6- — CID 6898631
4-[(E)-[[2-(2,5-dimethylphenoxy)acetyl]hydrazinylidene]methyl]-2-methoxy-6-nitrophenolate (PubChem CID 6898631) has the molecular formula C18H18N3O6- and a molecular weight of 372.36 g/mol. Its IUPAC name is 4-[(E)-[[2-(2,5-dimethylphenoxy)acetyl]hydrazinylidene]methyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(E)-[[2-(2,5-dimethylphenoxy)acetyl]hydrazinylidene]methyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 6898631 |
| Molecular Formula | C18H18N3O6- |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 4-[(E)-[[2-(2,5-dimethylphenoxy)acetyl]hydrazinylidene]methyl]-2-methoxy-6-nitrophenolate |
| SMILES | COc1cc(/C=N/NC(=O)COc2cc(C)ccc2C)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C18H19N3O6/c1-11-4-5-12(2)15(6-11)27-10-17(22)20-19-9-13-7-14(21(24)25)18(23)16(8-13)26-3/h4-9,23H,10H2,1-3H3,(H,20,22)/p-1/b19-9+ |
| InChIKey | YMENVKPMDCMZGI-DJKKODMXSA-M |
| XLogP | 1.82 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|