C20H23N3O4 — CID 8519000
N-[(Z)-(4-methyl-3-nitrophenyl)methylideneamino]-2-(5-methyl-2-propan-2-ylphenoxy)acetamide (PubChem CID 8519000) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-[(Z)-(4-methyl-3-nitrophenyl)methylideneamino]-2-(5-methyl-2-propan-2-ylphenoxy)acetamide.
| Compound Name | N-[(Z)-(4-methyl-3-nitrophenyl)methylideneamino]-2-(5-methyl-2-propan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 8519000 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N-[(Z)-(4-methyl-3-nitrophenyl)methylideneamino]-2-(5-methyl-2-propan-2-ylphenoxy)acetamide |
| SMILES | Cc1ccc(C(C)C)c(OCC(=O)N/N=C\c2ccc(C)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C20H23N3O4/c1-13(2)17-8-5-14(3)9-19(17)27-12-20(24)22-21-11-16-7-6-15(4)18(10-16)23(25)26/h5-11,13H,12H2,1-4H3,(H,22,24)/b21-11- |
| InChIKey | DVQKDYKIUAGWAS-NHDPSOOVSA-N |
| XLogP | 3.86 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|