C18H19N3O6 — CID 3899289
2-(3,5-dimethylphenoxy)-N-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]acetamide (PubChem CID 3899289) has the molecular formula C18H19N3O6 and a molecular weight of 373.37 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)-N-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(3,5-dimethylphenoxy)-N-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3899289 |
| Molecular Formula | C18H19N3O6 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)-N-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]acetamide |
| SMILES | COc1cc(C=NNC(=O)COc2cc(C)cc(C)c2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C18H19N3O6/c1-11-4-12(2)6-14(5-11)27-10-17(22)20-19-9-13-7-15(21(24)25)18(23)16(8-13)26-3/h4-9,23H,10H2,1-3H3,(H,20,22) |
| InChIKey | GMOKUECLYQEZRR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|