C17H17N3O4 — CID 966519
2-(3,5-dimethylphenoxy)-N-[(2-nitrophenyl)methylideneamino]acetamide (PubChem CID 966519) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)-N-[(2-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(3,5-dimethylphenoxy)-N-[(2-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 966519 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)-N-[(2-nitrophenyl)methylideneamino]acetamide |
| SMILES | Cc1cc(C)cc(OCC(=O)NN=Cc2ccccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17N3O4/c1-12-7-13(2)9-15(8-12)24-11-17(21)19-18-10-14-5-3-4-6-16(14)20(22)23/h3-10H,11H2,1-2H3,(H,19,21) |
| InChIKey | LPGUHOZGWOJXOZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|