C17H16ClN3O5 — CID 135938810
2-(4-chloro-3,5-dimethylphenoxy)-N-[(Z)-(2-hydroxy-3-nitrophenyl)methylideneamino]acetamide (PubChem CID 135938810) has the molecular formula C17H16ClN3O5 and a molecular weight of 377.78 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)-N-[(Z)-(2-hydroxy-3-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-[(Z)-(2-hydroxy-3-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135938810 |
| Molecular Formula | C17H16ClN3O5 |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-[(Z)-(2-hydroxy-3-nitrophenyl)methylideneamino]acetamide |
| SMILES | Cc1cc(OCC(=O)N/N=C\c2cccc([N+](=O)[O-])c2O)cc(C)c1Cl |
| InChI | InChI=1S/C17H16ClN3O5/c1-10-6-13(7-11(2)16(10)18)26-9-15(22)20-19-8-12-4-3-5-14(17(12)23)21(24)25/h3-8,23H,9H2,1-2H3,(H,20,22)/b19-8- |
| InChIKey | RTXHRDKDQPNCIC-UWVJOHFNSA-N |
| XLogP | 3.10 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|