C18H19ClN2O2 — CID 5419126
2-(4-chloro-3,5-dimethylphenoxy)-N-[(Z)-(2-methylphenyl)methylideneamino]acetamide (PubChem CID 5419126) has the molecular formula C18H19ClN2O2 and a molecular weight of 330.82 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)-N-[(Z)-(2-methylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-[(Z)-(2-methylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5419126 |
| Molecular Formula | C18H19ClN2O2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-[(Z)-(2-methylphenyl)methylideneamino]acetamide |
| SMILES | Cc1ccccc1/C=N\NC(=O)COc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C18H19ClN2O2/c1-12-6-4-5-7-15(12)10-20-21-17(22)11-23-16-8-13(2)18(19)14(3)9-16/h4-10H,11H2,1-3H3,(H,21,22)/b20-10- |
| InChIKey | JQICQYQTRXTLCK-JMIUGGIZSA-N |
| XLogP | 3.79 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|