C20H23ClN2O5 — CID 5433203
2-(4-chloro-3,5-dimethylphenoxy)-N-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]acetamide (PubChem CID 5433203) has the molecular formula C20H23ClN2O5 and a molecular weight of 406.87 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)-N-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5433203 |
| Molecular Formula | C20H23ClN2O5 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(OC)c(OC)cc1/C=N\NC(=O)COc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C20H23ClN2O5/c1-12-6-15(7-13(2)20(12)21)28-11-19(24)23-22-10-14-8-17(26-4)18(27-5)9-16(14)25-3/h6-10H,11H2,1-5H3,(H,23,24)/b22-10- |
| InChIKey | OBTNWXODKSJIBP-YVNNLAQVSA-N |
| XLogP | 3.51 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|