C17H18N4O6 — CID 135725870
N-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-(3-methoxyanilino)acetamide (PubChem CID 135725870) has the molecular formula C17H18N4O6 and a molecular weight of 374.35 g/mol. Its IUPAC name is N-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-(3-methoxyanilino)acetamide.
| Compound Name | N-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-(3-methoxyanilino)acetamide |
|---|---|
| PubChem CID | 135725870 |
| Molecular Formula | C17H18N4O6 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | N-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-(3-methoxyanilino)acetamide |
| SMILES | COc1cccc(NCC(=O)N/N=C\c2cc(OC)c(O)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C17H18N4O6/c1-26-13-5-3-4-12(8-13)18-10-16(22)20-19-9-11-6-14(21(24)25)17(23)15(7-11)27-2/h3-9,18,23H,10H2,1-2H3,(H,20,22)/b19-9- |
| InChIKey | WOYAQKBYYIEXQZ-OCKHKDLRSA-N |
| XLogP | 1.88 |
| TPSA | 135.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|