C13H13N7O7 — CID 135830610
2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]acetamide (PubChem CID 135830610) has the molecular formula C13H13N7O7 and a molecular weight of 379.29 g/mol. Its IUPAC name is 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135830610 |
| Molecular Formula | C13H13N7O7 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)CNc2n[nH]c(=O)[nH]c2=O)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C13H13N7O7/c1-27-8-3-6(2-7(10(8)22)20(25)26)4-15-17-9(21)5-14-11-12(23)16-13(24)19-18-11/h2-4,22H,5H2,1H3,(H,14,18)(H,17,21)(H2,16,19,23,24)/b15-4- |
| InChIKey | SNRCCHZTEPDMDU-TVPGTPATSA-N |
| XLogP | -1.36 |
| TPSA | 204.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|