C17H15N3O7 — CID 137180690
N-[(Z)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]-1,3-benzodioxole-5-carboxamide (PubChem CID 137180690) has the molecular formula C17H15N3O7 and a molecular weight of 373.32 g/mol. Its IUPAC name is N-[(Z)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(Z)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 137180690 |
| Molecular Formula | C17H15N3O7 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | N-[(Z)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]-1,3-benzodioxole-5-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccc3c(c2)OCO3)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C17H15N3O7/c1-2-25-15-6-10(5-12(16(15)21)20(23)24)8-18-19-17(22)11-3-4-13-14(7-11)27-9-26-13/h3-8,21H,2,9H2,1H3,(H,19,22)/b18-8- |
| InChIKey | RCSAHMYHYBYFRJ-LSCVHKIXSA-N |
| XLogP | 2.19 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|