C18H17IN2O5 — CID 136758877
N-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 136758877) has the molecular formula C18H17IN2O5 and a molecular weight of 468.25 g/mol. Its IUPAC name is N-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 136758877 |
| Molecular Formula | C18H17IN2O5 |
| Molecular Weight | 468.25 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | N-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccc3c(c2)OCCO3)cc(I)c1O |
| InChI | InChI=1S/C18H17IN2O5/c1-2-24-16-8-11(7-13(19)17(16)22)10-20-21-18(23)12-3-4-14-15(9-12)26-6-5-25-14/h3-4,7-10,22H,2,5-6H2,1H3,(H,21,23)/b20-10- |
| InChIKey | WGEUJEOAVQIBJO-JMIUGGIZSA-N |
| XLogP | 2.93 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|