C16H12Br2N2O4 — CID 136773628
N-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 136773628) has the molecular formula C16H12Br2N2O4 and a molecular weight of 456.09 g/mol. Its IUPAC name is N-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 136773628 |
| Molecular Formula | C16H12Br2N2O4 |
| Molecular Weight | 456.09 g/mol |
| Exact Mass | 453.92 |
| IUPAC Name | N-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | O=C(N/N=C\c1cc(Br)c(O)c(Br)c1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H12Br2N2O4/c17-11-5-9(6-12(18)15(11)21)8-19-20-16(22)10-1-2-13-14(7-10)24-4-3-23-13/h1-2,5-8,21H,3-4H2,(H,20,22)/b19-8- |
| InChIKey | UMKNPNBSLAMVPB-UWVJOHFNSA-N |
| XLogP | 3.45 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.09 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|