C14H11Br2N3O2 — CID 136789352
4-amino-N-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]benzamide (PubChem CID 136789352) has the molecular formula C14H11Br2N3O2 and a molecular weight of 413.07 g/mol. Its IUPAC name is 4-amino-N-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-amino-N-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 136789352 |
| Molecular Formula | C14H11Br2N3O2 |
| Molecular Weight | 413.07 g/mol |
| Exact Mass | 410.92 |
| IUPAC Name | 4-amino-N-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]benzamide |
| SMILES | Nc1ccc(C(=O)N/N=C\c2cc(Br)c(O)c(Br)c2)cc1 |
| InChI | InChI=1S/C14H11Br2N3O2/c15-11-5-8(6-12(16)13(11)20)7-18-19-14(21)9-1-3-10(17)4-2-9/h1-7,20H,17H2,(H,19,21)/b18-7- |
| InChIKey | PGEACJCWIJCJPM-WSVATBPTSA-N |
| XLogP | 3.26 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.07 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|