C20H14Br2N2O3 — CID 136593098
N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-4-phenoxybenzamide (PubChem CID 136593098) has the molecular formula C20H14Br2N2O3 and a molecular weight of 490.15 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-4-phenoxybenzamide.
| Compound Name | N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-4-phenoxybenzamide |
|---|---|
| PubChem CID | 136593098 |
| Molecular Formula | C20H14Br2N2O3 |
| Molecular Weight | 490.15 g/mol |
| Exact Mass | 487.94 |
| IUPAC Name | N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-4-phenoxybenzamide |
| SMILES | O=C(NN=Cc1cc(Br)c(O)c(Br)c1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C20H14Br2N2O3/c21-17-10-13(11-18(22)19(17)25)12-23-24-20(26)14-6-8-16(9-7-14)27-15-4-2-1-3-5-15/h1-12,25H,(H,24,26) |
| InChIKey | HDSMKTVEEBZPAW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.15 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|