C13H9Br2N3O2 — CID 135533190
N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]pyridine-3-carboxamide (PubChem CID 135533190) has the molecular formula C13H9Br2N3O2 and a molecular weight of 399.04 g/mol. Its IUPAC name is N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135533190 |
| Molecular Formula | C13H9Br2N3O2 |
| Molecular Weight | 399.04 g/mol |
| Exact Mass | 396.91 |
| IUPAC Name | N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]pyridine-3-carboxamide |
| SMILES | O=C(N/N=C/c1cc(Br)c(O)c(Br)c1)c1cccnc1 |
| InChI | InChI=1S/C13H9Br2N3O2/c14-10-4-8(5-11(15)12(10)19)6-17-18-13(20)9-2-1-3-16-7-9/h1-7,19H,(H,18,20)/b17-6+ |
| InChIKey | HZJJUKVYCGGFJN-UBKPWBPPSA-N |
| XLogP | 3.08 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.04 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|