C22H18Br2N2O4 — CID 136621265
N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-3-(4-methoxy-3-methylphenoxy)benzamide (PubChem CID 136621265) has the molecular formula C22H18Br2N2O4 and a molecular weight of 534.20 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-3-(4-methoxy-3-methylphenoxy)benzamide.
| Compound Name | N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-3-(4-methoxy-3-methylphenoxy)benzamide |
|---|---|
| PubChem CID | 136621265 |
| Molecular Formula | C22H18Br2N2O4 |
| Molecular Weight | 534.20 g/mol |
| Exact Mass | 531.96 |
| IUPAC Name | N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-3-(4-methoxy-3-methylphenoxy)benzamide |
| SMILES | COc1ccc(Oc2cccc(C(=O)NN=Cc3cc(Br)c(O)c(Br)c3)c2)cc1C |
| InChI | InChI=1S/C22H18Br2N2O4/c1-13-8-17(6-7-20(13)29-2)30-16-5-3-4-15(11-16)22(28)26-25-12-14-9-18(23)21(27)19(24)10-14/h3-12,27H,1-2H3,(H,26,28) |
| InChIKey | XWZCNSUVESHSHD-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.20 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|