C21H17Br2N3O5S — CID 135923632
N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-3-[3-(methanesulfonamido)phenoxy]benzamide (PubChem CID 135923632) has the molecular formula C21H17Br2N3O5S and a molecular weight of 583.26 g/mol. Its IUPAC name is N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-3-[3-(methanesulfonamido)phenoxy]benzamide.
| Compound Name | N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-3-[3-(methanesulfonamido)phenoxy]benzamide |
|---|---|
| PubChem CID | 135923632 |
| Molecular Formula | C21H17Br2N3O5S |
| Molecular Weight | 583.26 g/mol |
| Exact Mass | 580.93 |
| IUPAC Name | N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-3-[3-(methanesulfonamido)phenoxy]benzamide |
| SMILES | CS(=O)(=O)Nc1cccc(Oc2cccc(C(=O)N/N=C/c3cc(Br)c(O)c(Br)c3)c2)c1 |
| InChI | InChI=1S/C21H17Br2N3O5S/c1-32(29,30)26-15-5-3-7-17(11-15)31-16-6-2-4-14(10-16)21(28)25-24-12-13-8-18(22)20(27)19(23)9-13/h2-12,26-27H,1H3,(H,25,28)/b24-12+ |
| InChIKey | KDKCYXRRLLCDEE-WYMPLXKRSA-N |
| XLogP | 4.84 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.26 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|