C18H19Br2N3O2 — CID 2378017
N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-4-(diethylamino)benzamide (PubChem CID 2378017) has the molecular formula C18H19Br2N3O2 and a molecular weight of 469.18 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-4-(diethylamino)benzamide.
| Compound Name | N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-4-(diethylamino)benzamide |
|---|---|
| PubChem CID | 2378017 |
| Molecular Formula | C18H19Br2N3O2 |
| Molecular Weight | 469.18 g/mol |
| Exact Mass | 466.98 |
| IUPAC Name | N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-4-(diethylamino)benzamide |
| SMILES | CCN(CC)c1ccc(C(=O)NN=Cc2cc(Br)c(O)c(Br)c2)cc1 |
| InChI | InChI=1S/C18H19Br2N3O2/c1-3-23(4-2)14-7-5-13(6-8-14)18(25)22-21-11-12-9-15(19)17(24)16(20)10-12/h5-11,24H,3-4H2,1-2H3,(H,22,25) |
| InChIKey | IJIRWSTXRFVJFJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.18 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|