C17H13F5N2O4 — CID 5031020
3,4,5-trimethoxy-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzamide (PubChem CID 5031020) has the molecular formula C17H13F5N2O4 and a molecular weight of 404.29 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 5031020 |
| Molecular Formula | C17H13F5N2O4 |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzamide |
| SMILES | COc1cc(C(=O)NN=Cc2c(F)c(F)c(F)c(F)c2F)cc(OC)c1OC |
| InChI | InChI=1S/C17H13F5N2O4/c1-26-9-4-7(5-10(27-2)16(9)28-3)17(25)24-23-6-8-11(18)13(20)15(22)14(21)12(8)19/h4-6H,1-3H3,(H,24,25) |
| InChIKey | WFAHWONEQWQWEE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|