C19H21N3O9 — CID 136908103
N-[(Z)-(6-hydroxy-2,4-dimethoxy-3-nitrophenyl)methylideneamino]-3,4,5-trimethoxybenzamide (PubChem CID 136908103) has the molecular formula C19H21N3O9 and a molecular weight of 435.39 g/mol. Its IUPAC name is N-[(Z)-(6-hydroxy-2,4-dimethoxy-3-nitrophenyl)methylideneamino]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(Z)-(6-hydroxy-2,4-dimethoxy-3-nitrophenyl)methylideneamino]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 136908103 |
| Molecular Formula | C19H21N3O9 |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-[(Z)-(6-hydroxy-2,4-dimethoxy-3-nitrophenyl)methylideneamino]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)N/N=C\c2c(O)cc(OC)c([N+](=O)[O-])c2OC)cc(OC)c1OC |
| InChI | InChI=1S/C19H21N3O9/c1-27-13-8-12(23)11(17(30-4)16(13)22(25)26)9-20-21-19(24)10-6-14(28-2)18(31-5)15(7-10)29-3/h6-9,23H,1-5H3,(H,21,24)/b20-9- |
| InChIKey | KVMJNRAUBKUYOI-UKWGHVSLSA-N |
| XLogP | 2.11 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|