C19H20F2N2O6 — CID 9231738
N-[(Z)-[2-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-3,4,5-trimethoxybenzamide (PubChem CID 9231738) has the molecular formula C19H20F2N2O6 and a molecular weight of 410.37 g/mol. Its IUPAC name is N-[(Z)-[2-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(Z)-[2-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 9231738 |
| Molecular Formula | C19H20F2N2O6 |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-[(Z)-[2-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cccc(/C=N\NC(=O)c2cc(OC)c(OC)c(OC)c2)c1OC(F)F |
| InChI | InChI=1S/C19H20F2N2O6/c1-25-13-7-5-6-11(16(13)29-19(20)21)10-22-23-18(24)12-8-14(26-2)17(28-4)15(9-12)27-3/h5-10,19H,1-4H3,(H,23,24)/b22-10- |
| InChIKey | JSFRUCSCLSPDRZ-YVNNLAQVSA-N |
| XLogP | 3.09 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|